C7H13Br3S2 — CID 87354859
2-bromo-1,3-bis(2-bromoethylsulfanyl)propane (PubChem CID 87354859) has the molecular formula C7H13Br3S2 and a molecular weight of 401.03 g/mol. Its IUPAC name is 2-bromo-1,3-bis(2-bromoethylsulfanyl)propane.
| Compound Name | 2-bromo-1,3-bis(2-bromoethylsulfanyl)propane |
|---|---|
| PubChem CID | 87354859 |
| Molecular Formula | C7H13Br3S2 |
| Molecular Weight | 401.03 g/mol |
| Exact Mass | 397.80 |
| IUPAC Name | 2-bromo-1,3-bis(2-bromoethylsulfanyl)propane |
| SMILES | BrCCSCC(Br)CSCCBr |
| InChI | InChI=1S/C7H13Br3S2/c8-1-3-11-5-7(10)6-12-4-2-9/h7H,1-6H2 |
| InChIKey | ORXZVHDOSGWTEW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.03 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|