C35H51N5O9 — CID 67321997
but-2-enedioic acid;2-ethoxy-5-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]-1-phenylimidazole-4-carboxamide (PubChem CID 67321997) has the molecular formula C35H51N5O9 and a molecular weight of 685.82 g/mol. Its IUPAC name is but-2-enedioic acid;2-ethoxy-5-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]-1-phenylimidazole-4-carboxamide.
| Compound Name | but-2-enedioic acid;2-ethoxy-5-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]-1-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 67321997 |
| Molecular Formula | C35H51N5O9 |
| Molecular Weight | 685.82 g/mol |
| Exact Mass | 685.37 |
| IUPAC Name | but-2-enedioic acid;2-ethoxy-5-(4-methoxybutyl)-N-(2-methylpropyl)-N-[(3S,5R)-5-(morpholine-4-carbonyl)piperidin-3-yl]-1-phenylimidazole-4-carboxamide |
| SMILES | CCOc1nc(C(=O)N(CC(C)C)[C@@H]2CNC[C@H](C(=O)N3CCOCC3)C2)c(CCCCOC)n1-c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C31H47N5O5.C4H4O4/c1-5-41-31-33-28(27(13-9-10-16-39-4)36(31)25-11-7-6-8-12-25)30(38)35(22-23(2)3)26-19-24(20-32-21-26)29(37)34-14-17-40-18-15-34;5-3(6)1-2-4(7)8/h6-8,11-12,23-24,26,32H,5,9-10,13-22H2,1-4H3;1-2H,(H,5,6)(H,7,8)/t24-,26+;/m1./s1 |
| InChIKey | UNLGZQFIAYAGGN-OTTABGKNSA-N |
| XLogP | 2.89 |
| TPSA | 172.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|