C26H29FN4O2 — CID 67322466
propan-2-yl 2-[4-[[3-(2-fluoroanilino)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 67322466) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is propan-2-yl 2-[4-[[3-(2-fluoroanilino)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-[4-[[3-(2-fluoroanilino)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67322466 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | propan-2-yl 2-[4-[[3-(2-fluoroanilino)phenyl]methyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CC(C)OC(=O)c1cccnc1N1CCN(Cc2cccc(Nc3ccccc3F)c2)CC1 |
| InChI | InChI=1S/C26H29FN4O2/c1-19(2)33-26(32)22-9-6-12-28-25(22)31-15-13-30(14-16-31)18-20-7-5-8-21(17-20)29-24-11-4-3-10-23(24)27/h3-12,17,19,29H,13-16,18H2,1-2H3 |
| InChIKey | LCBAALLFIBVBMZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |