C21H20FN3O4 — CID 67322650
8-fluoro-N-(3-hydroxyoxan-4-yl)-4-[(6-oxo-1H-pyridin-3-yl)methyl]quinoline-2-carboxamide (PubChem CID 67322650) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is 8-fluoro-N-(3-hydroxyoxan-4-yl)-4-[(6-oxo-1H-pyridin-3-yl)methyl]quinoline-2-carboxamide.
| Compound Name | 8-fluoro-N-(3-hydroxyoxan-4-yl)-4-[(6-oxo-1H-pyridin-3-yl)methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 67322650 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 8-fluoro-N-(3-hydroxyoxan-4-yl)-4-[(6-oxo-1H-pyridin-3-yl)methyl]quinoline-2-carboxamide |
| SMILES | O=C(NC1CCOCC1O)c1cc(Cc2ccc(=O)[nH]c2)c2cccc(F)c2n1 |
| InChI | InChI=1S/C21H20FN3O4/c22-15-3-1-2-14-13(8-12-4-5-19(27)23-10-12)9-17(24-20(14)15)21(28)25-16-6-7-29-11-18(16)26/h1-5,9-10,16,18,26H,6-8,11H2,(H,23,27)(H,25,28) |
| InChIKey | HJMKGXYXOPPNTL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |