C25H27N3O3 — CID 54767685
N-[(3R,4S)-3-hydroxyoxan-4-yl]-4-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydroquinoline-2-carboxamide (PubChem CID 54767685) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[(3R,4S)-3-hydroxyoxan-4-yl]-4-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydroquinoline-2-carboxamide.
| Compound Name | N-[(3R,4S)-3-hydroxyoxan-4-yl]-4-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydroquinoline-2-carboxamide |
|---|---|
| PubChem CID | 54767685 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[(3R,4S)-3-hydroxyoxan-4-yl]-4-(quinolin-3-ylmethyl)-5,6,7,8-tetrahydroquinoline-2-carboxamide |
| SMILES | O=C(N[C@H]1CCOC[C@@H]1O)c1cc(Cc2cnc3ccccc3c2)c2c(n1)CCCC2 |
| InChI | InChI=1S/C25H27N3O3/c29-24-15-31-10-9-22(24)28-25(30)23-13-18(19-6-2-4-8-21(19)27-23)12-16-11-17-5-1-3-7-20(17)26-14-16/h1,3,5,7,11,13-14,22,24,29H,2,4,6,8-10,12,15H2,(H,28,30)/t22-,24-/m0/s1 |
| InChIKey | CQJUBOGEULWXHS-UPVQGACJSA-N |
| XLogP | 2.98 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |