C24H26N4O3S — CID 134309149
N-[(3S,4S)-3-hydroxyoxan-4-yl]-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide (PubChem CID 134309149) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-[(3S,4S)-3-hydroxyoxan-4-yl]-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide.
| Compound Name | N-[(3S,4S)-3-hydroxyoxan-4-yl]-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 134309149 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-[(3S,4S)-3-hydroxyoxan-4-yl]-4-[[4-(1,3-thiazol-4-yl)phenyl]methyl]-5,6,7,8-tetrahydro-1,7-naphthyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCOC[C@H]1O)c1cc(Cc2ccc(-c3cscn3)cc2)c2c(n1)CNCC2 |
| InChI | InChI=1S/C24H26N4O3S/c29-23-12-31-8-6-19(23)28-24(30)20-10-17(18-5-7-25-11-21(18)27-20)9-15-1-3-16(4-2-15)22-13-32-14-26-22/h1-4,10,13-14,19,23,25,29H,5-9,11-12H2,(H,28,30)/t19-,23+/m0/s1 |
| InChIKey | NEXIUBBVPBZESN-WMZHIEFXSA-N |
| XLogP | 2.32 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |