C49H60N10 — CID 67323715
(E)-N-ethyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine;(E)-N-methyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine (PubChem CID 67323715) has the molecular formula C49H60N10 and a molecular weight of 789.09 g/mol. Its IUPAC name is (E)-N-ethyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine;(E)-N-methyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine.
| Compound Name | (E)-N-ethyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine;(E)-N-methyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 67323715 |
| Molecular Formula | C49H60N10 |
| Molecular Weight | 789.09 g/mol |
| Exact Mass | 788.50 |
| IUPAC Name | (E)-N-ethyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine;(E)-N-methyl-N,N',N'-tris[(5-methyl-2-pyridinyl)methyl]ethene-1,2-diamine |
| SMILES | CCN(/C=C/N(Cc1ccc(C)cn1)Cc1ccc(C)cn1)Cc1ccc(C)cn1.Cc1ccc(CN(C)/C=C/N(Cc2ccc(C)cn2)Cc2ccc(C)cn2)nc1 |
| InChI | InChI=1S/C25H31N5.C24H29N5/c1-5-29(17-23-9-6-20(2)14-26-23)12-13-30(18-24-10-7-21(3)15-27-24)19-25-11-8-22(4)16-28-25;1-19-5-8-22(25-13-19)16-28(4)11-12-29(17-23-9-6-20(2)14-26-23)18-24-10-7-21(3)15-27-24/h6-16H,5,17-19H2,1-4H3;5-15H,16-18H2,1-4H3/b13-12+;12-11+ |
| InChIKey | MHOAPBBLQFFCGD-ZJXFPNIXSA-N |
| XLogP | 9.19 |
| TPSA | 90.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.09 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |