C7H11N3S — CID 67325580
N-ethyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 67325580) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is N-ethyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-ethyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 67325580 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-ethyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCNc1ccnc(SC)n1 |
| InChI | InChI=1S/C7H11N3S/c1-3-8-6-4-5-9-7(10-6)11-2/h4-5H,3H2,1-2H3,(H,8,9,10) |
| InChIKey | XDATXFTXDBHACS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |