About 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate
1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate (PubChem CID 67326036) has the molecular formula C24H26N2O5S
and a molecular weight of 454.55 g/mol. Its IUPAC name is 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate |
| PubChem CID | 67326036 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2cc1OCCC1CCN(C(=O)OCc2nccs2)CC1 |
| InChI | InChI=1S/C24H26N2O5S/c1-29-23(27)20-14-18-4-2-3-5-19(18)15-21(20)30-12-8-17-6-10-26(11-7-17)24(28)31-16-22-25-9-13-32-22/h2-5,9,13-15,17H,6-8,10-12,16H2,1H3 |
| InChIKey | NMOYCIGAWHGJSP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate?
The IUPAC name of 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate (CID 67326036) is 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate.
What is the SMILES notation for 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate?
The canonical SMILES for 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate is COC(=O)c1cc2ccccc2cc1OCCC1CCN(C(=O)OCc2nccs2)CC1.
What is the InChIKey of 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate?
The InChIKey is NMOYCIGAWHGJSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O5S/c1-29-23(27)20-14-18-4-2-3-5-19(18)15-21(20)30-12-8-17-6-10-26(11-7-17)24(28)31-16-22-25-9-13-32-22/h2-5,9,13-15,17H,6-8,10-12,16H2,1H3.
What are the key properties of 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate?
1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate has a molecular weight of 454.55 g/mol, XLogP of 4.90, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-2-ylmethyl 4-[2-(3-methoxycarbonylnaphthalen-2-yl)oxyethyl]piperidine-1-carboxylate is sourced from PubChem (CID 67326036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).