C12H23N3O3 — CID 67328029
(2S)-2-amino-5-[(2-piperidin-3-ylacetyl)amino]pentanoic acid (PubChem CID 67328029) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2S)-2-amino-5-[(2-piperidin-3-ylacetyl)amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[(2-piperidin-3-ylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 67328029 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (2S)-2-amino-5-[(2-piperidin-3-ylacetyl)amino]pentanoic acid |
| SMILES | N[C@@H](CCCNC(=O)CC1CCCNC1)C(=O)O |
| InChI | InChI=1S/C12H23N3O3/c13-10(12(17)18)4-2-6-15-11(16)7-9-3-1-5-14-8-9/h9-10,14H,1-8,13H2,(H,15,16)(H,17,18)/t9?,10-/m0/s1 |
| InChIKey | CIFJQEACRUZCOZ-AXDSSHIGSA-N |
| XLogP | -0.32 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|