C27H27Cl2F3N4O6S — CID 67329793
5-[[(2,6-dichlorophenyl)sulfonyl-ethylamino]methyl]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 67329793) has the molecular formula C27H27Cl2F3N4O6S and a molecular weight of 663.50 g/mol. Its IUPAC name is 5-[[(2,6-dichlorophenyl)sulfonyl-ethylamino]methyl]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[[(2,6-dichlorophenyl)sulfonyl-ethylamino]methyl]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67329793 |
| Molecular Formula | C27H27Cl2F3N4O6S |
| Molecular Weight | 663.50 g/mol |
| Exact Mass | 662.10 |
| IUPAC Name | 5-[[(2,6-dichlorophenyl)sulfonyl-ethylamino]methyl]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]furan-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(Cc1cc(C(=O)NCCc2ccc(C3=NCCN3)cc2)co1)S(=O)(=O)c1c(Cl)cccc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H26Cl2N4O4S.C2HF3O2/c1-2-31(36(33,34)23-21(26)4-3-5-22(23)27)15-20-14-19(16-35-20)25(32)30-11-10-17-6-8-18(9-7-17)24-28-12-13-29-24;3-2(4,5)1(6)7/h3-9,14,16H,2,10-13,15H2,1H3,(H,28,29)(H,30,32);(H,6,7) |
| InChIKey | VDDHUBRHHACNJN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |