C7H17N3 — CID 67330739
1-N'-[2-(azetidin-3-yl)ethyl]ethane-1,1-diamine (PubChem CID 67330739) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is 1-N'-[2-(azetidin-3-yl)ethyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[2-(azetidin-3-yl)ethyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 67330739 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | 1-N'-[2-(azetidin-3-yl)ethyl]ethane-1,1-diamine |
| SMILES | CC(N)NCCC1CNC1 |
| InChI | InChI=1S/C7H17N3/c1-6(8)10-3-2-7-4-9-5-7/h6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | ANUYVPHXMHOKMY-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|