C18H20N4O — CID 67332589
2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzoxazol-5-amine (PubChem CID 67332589) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 67332589 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzoxazol-5-amine |
| SMILES | CN1CCN(c2ccc(-c3nc4cc(N)ccc4o3)cc2)CC1 |
| InChI | InChI=1S/C18H20N4O/c1-21-8-10-22(11-9-21)15-5-2-13(3-6-15)18-20-16-12-14(19)4-7-17(16)23-18/h2-7,12H,8-11,19H2,1H3 |
| InChIKey | JCMYNEVOPFTLIN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|