C27H29N3O4S — CID 67334171
3-[7-[[6-(diethylaminomethyl)-1-benzothiophen-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 67334171) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 3-[7-[[6-(diethylaminomethyl)-1-benzothiophen-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[6-(diethylaminomethyl)-1-benzothiophen-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 67334171 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 3-[7-[[6-(diethylaminomethyl)-1-benzothiophen-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCN(CC)Cc1ccc2cc(COc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)sc2c1 |
| InChI | InChI=1S/C27H29N3O4S/c1-3-29(4-2)14-17-8-9-18-13-19(35-24(18)12-17)16-34-23-7-5-6-20-21(23)15-30(27(20)33)22-10-11-25(31)28-26(22)32/h5-9,12-13,22H,3-4,10-11,14-16H2,1-2H3,(H,28,31,32) |
| InChIKey | ZOGJDWUPSNMMAK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|