C17H18N2O2 — CID 67335399
4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexan-1-one (PubChem CID 67335399) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexan-1-one.
| Compound Name | 4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 67335399 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethenyl]cyclohexan-1-one |
| SMILES | COc1ccc2nccc(C=CC3CCC(=O)CC3)c2n1 |
| InChI | InChI=1S/C17H18N2O2/c1-21-16-9-8-15-17(19-16)13(10-11-18-15)5-2-12-3-6-14(20)7-4-12/h2,5,8-12H,3-4,6-7H2,1H3 |
| InChIKey | CBMHGTWJEFCNDH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |