C26H19FO3 — CID 67336682
4-(4-fluorophenyl)-2-[(E)-3-(8-hydroxynaphthalen-2-yl)prop-1-enyl]benzoic acid (PubChem CID 67336682) has the molecular formula C26H19FO3 and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-[(E)-3-(8-hydroxynaphthalen-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-(4-fluorophenyl)-2-[(E)-3-(8-hydroxynaphthalen-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 67336682 |
| Molecular Formula | C26H19FO3 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-(4-fluorophenyl)-2-[(E)-3-(8-hydroxynaphthalen-2-yl)prop-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)cc1/C=C/Cc1ccc2cccc(O)c2c1 |
| InChI | InChI=1S/C26H19FO3/c27-22-12-9-18(10-13-22)20-11-14-23(26(29)30)21(16-20)5-1-3-17-7-8-19-4-2-6-25(28)24(19)15-17/h1-2,4-16,28H,3H2,(H,29,30)/b5-1+ |
| InChIKey | ONGDORKIUXEQIG-ORCRQEGFSA-N |
| XLogP | 6.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |