C27H21FO3 — CID 67335582
4-(4-fluorophenyl)-2-[4-(6-hydroxynaphthalen-1-yl)but-1-enyl]benzoic acid (PubChem CID 67335582) has the molecular formula C27H21FO3 and a molecular weight of 412.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-[4-(6-hydroxynaphthalen-1-yl)but-1-enyl]benzoic acid.
| Compound Name | 4-(4-fluorophenyl)-2-[4-(6-hydroxynaphthalen-1-yl)but-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 67335582 |
| Molecular Formula | C27H21FO3 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-(4-fluorophenyl)-2-[4-(6-hydroxynaphthalen-1-yl)but-1-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)cc1C=CCCc1cccc2cc(O)ccc12 |
| InChI | InChI=1S/C27H21FO3/c28-23-11-8-18(9-12-23)20-10-14-26(27(30)31)21(16-20)5-2-1-4-19-6-3-7-22-17-24(29)13-15-25(19)22/h2-3,5-17,29H,1,4H2,(H,30,31) |
| InChIKey | HTYIITXWEAUQPV-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |