C26H19FO4 — CID 70014882
4-[4-[2-(4-fluorophenyl)-6-hydroxynaphthalen-1-yl]oxyphenyl]but-3-enoic acid (PubChem CID 70014882) has the molecular formula C26H19FO4 and a molecular weight of 414.43 g/mol. Its IUPAC name is 4-[4-[2-(4-fluorophenyl)-6-hydroxynaphthalen-1-yl]oxyphenyl]but-3-enoic acid.
| Compound Name | 4-[4-[2-(4-fluorophenyl)-6-hydroxynaphthalen-1-yl]oxyphenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 70014882 |
| Molecular Formula | C26H19FO4 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-[4-[2-(4-fluorophenyl)-6-hydroxynaphthalen-1-yl]oxyphenyl]but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1ccc(Oc2c(-c3ccc(F)cc3)ccc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C26H19FO4/c27-20-9-6-18(7-10-20)23-14-8-19-16-21(28)11-15-24(19)26(23)31-22-12-4-17(5-13-22)2-1-3-25(29)30/h1-2,4-16,28H,3H2,(H,29,30) |
| InChIKey | TYQMKIHNSOKHGD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |