C26H22O5 — CID 67603232
2-[4-[2-(4-hydroxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid (PubChem CID 67603232) has the molecular formula C26H22O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[4-[2-(4-hydroxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid.
| Compound Name | 2-[4-[2-(4-hydroxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 67603232 |
| Molecular Formula | C26H22O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[4-[2-(4-hydroxyphenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid |
| SMILES | COc1ccc2c(Oc3ccc(C(C)C(=O)O)cc3)c(-c3ccc(O)cc3)ccc2c1 |
| InChI | InChI=1S/C26H22O5/c1-16(26(28)29)17-5-10-21(11-6-17)31-25-23(18-3-8-20(27)9-4-18)13-7-19-15-22(30-2)12-14-24(19)25/h3-16,27H,1-2H3,(H,28,29) |
| InChIKey | HAUAMWRVWRYPOY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |