C26H21ClO4 — CID 67603134
2-[4-[2-(4-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid (PubChem CID 67603134) has the molecular formula C26H21ClO4 and a molecular weight of 432.90 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid.
| Compound Name | 2-[4-[2-(4-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 67603134 |
| Molecular Formula | C26H21ClO4 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[4-[2-(4-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]propanoic acid |
| SMILES | COc1ccc2c(Oc3ccc(C(C)C(=O)O)cc3)c(-c3ccc(Cl)cc3)ccc2c1 |
| InChI | InChI=1S/C26H21ClO4/c1-16(26(28)29)17-5-10-21(11-6-17)31-25-23(18-3-8-20(27)9-4-18)13-7-19-15-22(30-2)12-14-24(19)25/h3-16H,1-2H3,(H,28,29) |
| InChIKey | JAYNFYIKSXXCRR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |