C27H22O5 — CID 67602112
2-[4-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 67602112) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[4-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 2-[4-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67602112 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 2-[4-[6-methoxy-2-(4-methoxyphenyl)naphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(Oc2c(-c3ccc(OC)cc3)ccc3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C27H22O5/c1-17(27(28)29)18-4-11-22(12-5-18)32-26-24(19-6-9-21(30-2)10-7-19)14-8-20-16-23(31-3)13-15-25(20)26/h4-16H,1H2,2-3H3,(H,28,29) |
| InChIKey | WVZYKNPIEITYKN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|