C26H19ClO4 — CID 67602790
2-[4-[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 67602790) has the molecular formula C26H19ClO4 and a molecular weight of 430.89 g/mol. Its IUPAC name is 2-[4-[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | 2-[4-[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67602790 |
| Molecular Formula | C26H19ClO4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[4-[2-(3-chlorophenyl)-6-methoxynaphthalen-1-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(Oc2c(-c3cccc(Cl)c3)ccc3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C26H19ClO4/c1-16(26(28)29)17-6-9-21(10-7-17)31-25-23(18-4-3-5-20(27)14-18)12-8-19-15-22(30-2)11-13-24(19)25/h3-15H,1H2,2H3,(H,28,29) |
| InChIKey | WEXIVDZBRLVKHM-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|