C18H14N4O3S — CID 67337005
(E)-3-[4-[2-(furan-2-ylmethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]prop-2-enoic acid (PubChem CID 67337005) has the molecular formula C18H14N4O3S and a molecular weight of 366.40 g/mol. Its IUPAC name is (E)-3-[4-[2-(furan-2-ylmethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(furan-2-ylmethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67337005 |
| Molecular Formula | C18H14N4O3S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (E)-3-[4-[2-(furan-2-ylmethylamino)imidazo[2,1-b][1,3,4]thiadiazol-6-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2cn3nc(NCc4ccco4)sc3n2)cc1 |
| InChI | InChI=1S/C18H14N4O3S/c23-16(24)8-5-12-3-6-13(7-4-12)15-11-22-18(20-15)26-17(21-22)19-10-14-2-1-9-25-14/h1-9,11H,10H2,(H,19,21)(H,23,24)/b8-5+ |
| InChIKey | PUHLSZLZEJOOOB-VMPITWQZSA-N |
| XLogP | 3.76 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|