C16H23N5O8 — CID 67337440
(2R,3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 67337440) has the molecular formula C16H23N5O8 and a molecular weight of 413.39 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 67337440 |
| Molecular Formula | C16H23N5O8 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23N5O8/c1-5(27-16-11(26)8(23)6(2-22)28-16)12-9(24)10(25)15(29-12)21-4-20-7-13(17)18-3-19-14(7)21/h3-6,8-12,15-16,22-26H,2H2,1H3,(H2,17,18,19)/t5?,6-,8-,9+,10-,11-,12-,15-,16-/m1/s1 |
| InChIKey | LGOIXLNLIWXQAN-AGKPOKOUSA-N |
| XLogP | -3.13 |
| TPSA | 198.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |