C17H26N6O8 — CID 68657320
(3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 68657320) has the molecular formula C17H26N6O8 and a molecular weight of 442.43 g/mol. Its IUPAC name is (3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 68657320 |
| Molecular Formula | C17H26N6O8 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (3R,4S,5R)-2-[1-[(2S,3S,4R,5R)-5-[6-[amino(methyl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(OC1O[C@H](CO)[C@@H](O)[C@H]1O)[C@H]1O[C@@H](n2cnc3c(N(C)N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H26N6O8/c1-6(29-17-12(28)9(25)7(3-24)30-17)13-10(26)11(27)16(31-13)23-5-21-8-14(22(2)18)19-4-20-15(8)23/h4-7,9-13,16-17,24-28H,3,18H2,1-2H3/t6?,7-,9-,10+,11-,12-,13-,16-,17?/m1/s1 |
| InChIKey | WHVYIZNALFYVNO-VMSNIILRSA-N |
| XLogP | -3.40 |
| TPSA | 201.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|