C16H15ClN2O4S — CID 67338697
N-(3-chlorophenyl)-3-(3-methoxy-4-sulfamoylphenyl)prop-2-enamide (PubChem CID 67338697) has the molecular formula C16H15ClN2O4S and a molecular weight of 366.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(3-methoxy-4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | N-(3-chlorophenyl)-3-(3-methoxy-4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 67338697 |
| Molecular Formula | C16H15ClN2O4S |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-(3-chlorophenyl)-3-(3-methoxy-4-sulfamoylphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cccc(Cl)c2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C16H15ClN2O4S/c1-23-14-9-11(5-7-15(14)24(18,21)22)6-8-16(20)19-13-4-2-3-12(17)10-13/h2-10H,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | QWYLUMOPPLLJNF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|