C18H18ClN3O3S — CID 9480211
1-(3-chlorophenyl)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]thiourea (PubChem CID 9480211) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9480211 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]thiourea |
| SMILES | COc1ccc(/C=C/C(=O)NNC(=S)Nc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H18ClN3O3S/c1-24-15-8-6-12(10-16(15)25-2)7-9-17(23)21-22-18(26)20-14-5-3-4-13(19)11-14/h3-11H,1-2H3,(H,21,23)(H2,20,22,26)/b9-7+ |
| InChIKey | LAIYJFCLNIQQTM-VQHVLOKHSA-N |
| XLogP | 3.39 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|