C16H22N4O — CID 67338966
1H-indazole-3-carboxamide;(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 67338966) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 1H-indazole-3-carboxamide;(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | 1H-indazole-3-carboxamide;(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 67338966 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1H-indazole-3-carboxamide;(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@@H]2CCC[C@H]1CC2.NC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C8H7N3O.C8H15N/c9-8(12)7-5-3-1-2-4-6(5)10-11-7;1-9-7-3-2-4-8(9)6-5-7/h1-4H,(H2,9,12)(H,10,11);7-8H,2-6H2,1H3/t;7-,8+ |
| InChIKey | PSCSFYNRJRAGRO-YIEIKVQRSA-N |
| XLogP | 2.29 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |