C16H20N4O3 — CID 11681222
formic acid;1H-indazol-3-yl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 11681222) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is formic acid;1H-indazol-3-yl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | formic acid;1H-indazol-3-yl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 11681222 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | formic acid;1H-indazol-3-yl-(3-methyl-3,8-diazabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | CN1CC2CCC(C1)N2C(=O)c1n[nH]c2ccccc12.O=CO |
| InChI | InChI=1S/C15H18N4O.CH2O2/c1-18-8-10-6-7-11(9-18)19(10)15(20)14-12-4-2-3-5-13(12)16-17-14;2-1-3/h2-5,10-11H,6-9H2,1H3,(H,16,17);1H,(H,2,3) |
| InChIKey | XUQCKTUBGHTBJN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|