C19H16F3N3O2 — CID 67339467
1-(cyclohexylideneamino)-6-(3-hydroxyphenyl)-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 67339467) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-(cyclohexylideneamino)-6-(3-hydroxyphenyl)-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 1-(cyclohexylideneamino)-6-(3-hydroxyphenyl)-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 67339467 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-(cyclohexylideneamino)-6-(3-hydroxyphenyl)-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2cccc(O)c2)n(N=C2CCCCC2)c1=O |
| InChI | InChI=1S/C19H16F3N3O2/c20-19(21,22)16-10-17(12-5-4-8-14(26)9-12)25(18(27)15(16)11-23)24-13-6-2-1-3-7-13/h4-5,8-10,26H,1-3,6-7H2 |
| InChIKey | ARESNTFVSXIPES-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|