C19H16F3N3O — CID 59099238
1-(cyclohexylideneamino)-3-isocyano-6-phenyl-4-(trifluoromethyl)pyridin-2-one (PubChem CID 59099238) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 1-(cyclohexylideneamino)-3-isocyano-6-phenyl-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-(cyclohexylideneamino)-3-isocyano-6-phenyl-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59099238 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-(cyclohexylideneamino)-3-isocyano-6-phenyl-4-(trifluoromethyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2ccccc2)n(N=C2CCCCC2)c1=O |
| InChI | InChI=1S/C19H16F3N3O/c1-23-17-15(19(20,21)22)12-16(13-8-4-2-5-9-13)25(18(17)26)24-14-10-6-3-7-11-14/h2,4-5,8-9,12H,3,6-7,10-11H2 |
| InChIKey | PCRPBONOCPKEJU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|