C17H14F3N3O — CID 59099289
3-isocyano-1-[(E)-2-methylpropylideneamino]-6-phenyl-4-(trifluoromethyl)pyridin-2-one (PubChem CID 59099289) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is 3-isocyano-1-[(E)-2-methylpropylideneamino]-6-phenyl-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-isocyano-1-[(E)-2-methylpropylideneamino]-6-phenyl-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59099289 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-isocyano-1-[(E)-2-methylpropylideneamino]-6-phenyl-4-(trifluoromethyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2ccccc2)n(/N=C/C(C)C)c1=O |
| InChI | InChI=1S/C17H14F3N3O/c1-11(2)10-22-23-14(12-7-5-4-6-8-12)9-13(17(18,19)20)15(21-3)16(23)24/h4-11H,1-2H3/b22-10+ |
| InChIKey | GGOHPRBFVPQRJE-LSHDLFTRSA-N |
| XLogP | 4.57 |
| TPSA | 38.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|