C21H12F6N2O — CID 59099149
3-isocyano-6-(3-methylphenyl)-4-(trifluoromethyl)-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one (PubChem CID 59099149) has the molecular formula C21H12F6N2O and a molecular weight of 422.33 g/mol. Its IUPAC name is 3-isocyano-6-(3-methylphenyl)-4-(trifluoromethyl)-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one.
| Compound Name | 3-isocyano-6-(3-methylphenyl)-4-(trifluoromethyl)-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 59099149 |
| Molecular Formula | C21H12F6N2O |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 3-isocyano-6-(3-methylphenyl)-4-(trifluoromethyl)-1-[(2,4,5-trifluorophenyl)methyl]pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2cccc(C)c2)n(Cc2cc(F)c(F)cc2F)c1=O |
| InChI | InChI=1S/C21H12F6N2O/c1-11-4-3-5-12(6-11)18-8-14(21(25,26)27)19(28-2)20(30)29(18)10-13-7-16(23)17(24)9-15(13)22/h3-9H,10H2,1H3 |
| InChIKey | BOXZFSNXHVEKKF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|