C19H22ClNO2 — CID 6734048
3-phenylbutyl N-[2-(2-chlorophenyl)ethyl]carbamate (PubChem CID 6734048) has the molecular formula C19H22ClNO2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 3-phenylbutyl N-[2-(2-chlorophenyl)ethyl]carbamate.
| Compound Name | 3-phenylbutyl N-[2-(2-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 6734048 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-phenylbutyl N-[2-(2-chlorophenyl)ethyl]carbamate |
| SMILES | CC(CCOC(=O)NCCC1=CC=CC=C1Cl)C2=CC=CC=C2 |
| InChI | InChI=1S/C19H22ClNO2/c1-15(16-7-3-2-4-8-16)12-14-23-19(22)21-13-11-17-9-5-6-10-18(17)20/h2-10,15H,11-14H2,1H3,(H,21,22) |
| InChIKey | MTOKSYOFJVEHPR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | 344 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |