C17H16N4O — CID 67343124
3-pyridin-3-yl-5-[3-[(2R)-pyrrolidin-2-yl]phenyl]-1,2,4-oxadiazole (PubChem CID 67343124) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-pyridin-3-yl-5-[3-[(2R)-pyrrolidin-2-yl]phenyl]-1,2,4-oxadiazole.
| Compound Name | 3-pyridin-3-yl-5-[3-[(2R)-pyrrolidin-2-yl]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67343124 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-pyridin-3-yl-5-[3-[(2R)-pyrrolidin-2-yl]phenyl]-1,2,4-oxadiazole |
| SMILES | c1cncc(-c2noc(-c3cccc([C@H]4CCCN4)c3)n2)c1 |
| InChI | InChI=1S/C17H16N4O/c1-4-12(15-7-3-9-19-15)10-13(5-1)17-20-16(21-22-17)14-6-2-8-18-11-14/h1-2,4-6,8,10-11,15,19H,3,7,9H2/t15-/m1/s1 |
| InChIKey | LCWRDTCALDWQLY-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |