About pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate
pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 6734369) has the molecular formula C16H18F3N3O2
and a molecular weight of 341.33 g/mol. Its IUPAC name is pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| PubChem CID | 6734369 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CCC#CCOC(=O)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H18F3N3O2/c1-2-3-4-11-24-15(23)22-9-7-21(8-10-22)14-6-5-13(12-20-14)16(17,18)19/h5-6,12H,2,7-11H2,1H3 |
| InChIKey | JOLFSNVPJNKBLA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The IUPAC name of pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (CID 6734369) is pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
What is the SMILES notation for pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The canonical SMILES for pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate is CCC#CCOC(=O)N1CCN(c2ccc(C(F)(F)F)cn2)CC1.
What is the InChIKey of pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
The InChIKey is JOLFSNVPJNKBLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3N3O2/c1-2-3-4-11-24-15(23)22-9-7-21(8-10-22)14-6-5-13(12-20-14)16(17,18)19/h5-6,12H,2,7-11H2,1H3.
What are the key properties of pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate?
pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate has a molecular weight of 341.33 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pent-2-ynyl 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate is sourced from PubChem (CID 6734369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).