About 1-pyridin-3-ylhexyl N-methylcarbamate
1-pyridin-3-ylhexyl N-methylcarbamate (PubChem CID 67346880) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-pyridin-3-ylhexyl N-methylcarbamate.
Molecular Properties
| Compound Name | 1-pyridin-3-ylhexyl N-methylcarbamate |
| PubChem CID | 67346880 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-pyridin-3-ylhexyl N-methylcarbamate |
| SMILES | CCCCCC(OC(=O)NC)c1cccnc1 |
| InChI | InChI=1S/C13H20N2O2/c1-3-4-5-8-12(17-13(16)14-2)11-7-6-9-15-10-11/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,14,16) |
| InChIKey | QUMLZLUDVNOFTN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-3-ylhexyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-ylhexyl N-methylcarbamate?
The IUPAC name of 1-pyridin-3-ylhexyl N-methylcarbamate (CID 67346880) is 1-pyridin-3-ylhexyl N-methylcarbamate.
What is the SMILES notation for 1-pyridin-3-ylhexyl N-methylcarbamate?
The canonical SMILES for 1-pyridin-3-ylhexyl N-methylcarbamate is CCCCCC(OC(=O)NC)c1cccnc1.
What is the InChIKey of 1-pyridin-3-ylhexyl N-methylcarbamate?
The InChIKey is QUMLZLUDVNOFTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-3-4-5-8-12(17-13(16)14-2)11-7-6-9-15-10-11/h6-7,9-10,12H,3-5,8H2,1-2H3,(H,14,16).
What are the key properties of 1-pyridin-3-ylhexyl N-methylcarbamate?
1-pyridin-3-ylhexyl N-methylcarbamate has a molecular weight of 236.31 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-ylhexyl N-methylcarbamate is sourced from PubChem (CID 67346880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).