C24H23F3N6O — CID 67346923
N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 67346923) has the molecular formula C24H23F3N6O and a molecular weight of 468.48 g/mol. Its IUPAC name is N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 67346923 |
| Molecular Formula | C24H23F3N6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | COc1cc(Nc2nc3n(n2)CCC(c2ccccc2C(F)(F)F)C3)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H23F3N6O/c1-15-13-32(14-28-15)20-8-7-17(12-21(20)34-2)29-23-30-22-11-16(9-10-33(22)31-23)18-5-3-4-6-19(18)24(25,26)27/h3-8,12-14,16H,9-11H2,1-2H3,(H,29,31) |
| InChIKey | XYWPLSYNYLXUDV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |