C23H21F3N6O — CID 70226165
(7R)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 70226165) has the molecular formula C23H21F3N6O and a molecular weight of 454.46 g/mol. Its IUPAC name is (7R)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | (7R)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 70226165 |
| Molecular Formula | C23H21F3N6O |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (7R)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1nc(-c2nc3n(n2)CC[C@@H](c2cccc(C(F)(F)F)c2)C3)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C23H21F3N6O/c1-14-12-31(13-27-14)19-7-6-18(28-22(19)33-2)21-29-20-11-16(8-9-32(20)30-21)15-4-3-5-17(10-15)23(24,25)26/h3-7,10,12-13,16H,8-9,11H2,1-2H3/t16-/m1/s1 |
| InChIKey | XOBAACQZUNUAHQ-MRXNPFEDSA-N |
| XLogP | 4.59 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |