C24H27F3N6O2 — CID 91581396
2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-[3-(trifluoromethoxy)hepta-3,5-dien-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 91581396) has the molecular formula C24H27F3N6O2 and a molecular weight of 488.51 g/mol. Its IUPAC name is 2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-[3-(trifluoromethoxy)hepta-3,5-dien-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-[3-(trifluoromethoxy)hepta-3,5-dien-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 91581396 |
| Molecular Formula | C24H27F3N6O2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-8-[3-(trifluoromethoxy)hepta-3,5-dien-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CC=CC=C(OC(F)(F)F)C(C)C1CCCn2nc(-c3ccc(-n4cnc(C)c4)c(OC)n3)nc21 |
| InChI | InChI=1S/C24H27F3N6O2/c1-5-6-9-20(35-24(25,26)27)16(3)17-8-7-12-33-22(17)30-21(31-33)18-10-11-19(23(29-18)34-4)32-13-15(2)28-14-32/h5-6,9-11,13-14,16-17H,7-8,12H2,1-4H3 |
| InChIKey | NPTZDRWKEIBIRW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|