C27H32N6O3 — CID 87147414
8-(3-tert-butyl-2-methoxyphenyl)-2-[5-(4-methylimidazol-1-yl)-6-methylperoxy-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 87147414) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 8-(3-tert-butyl-2-methoxyphenyl)-2-[5-(4-methylimidazol-1-yl)-6-methylperoxy-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(3-tert-butyl-2-methoxyphenyl)-2-[5-(4-methylimidazol-1-yl)-6-methylperoxy-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 87147414 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 8-(3-tert-butyl-2-methoxyphenyl)-2-[5-(4-methylimidazol-1-yl)-6-methylperoxy-2-pyridinyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COOc1nc(-c2nc3n(n2)CCCC3c2cccc(C(C)(C)C)c2OC)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C27H32N6O3/c1-17-15-32(16-28-17)22-13-12-21(29-26(22)36-35-6)24-30-25-19(10-8-14-33(25)31-24)18-9-7-11-20(23(18)34-5)27(2,3)4/h7,9,11-13,15-16,19H,8,10,14H2,1-6H3 |
| InChIKey | PNRRCAIUMBXRCM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 89.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|