C23H23FN6O — CID 67606635
8-(4-fluorophenyl)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 67606635) has the molecular formula C23H23FN6O and a molecular weight of 418.48 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-(4-fluorophenyl)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 67606635 |
| Molecular Formula | C23H23FN6O |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 8-(4-fluorophenyl)-2-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-7-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1nc(-c2nc3n(n2)CCC(C)C3c2ccc(F)cc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C23H23FN6O/c1-14-10-11-30-22(20(14)16-4-6-17(24)7-5-16)27-21(28-30)18-8-9-19(23(26-18)31-3)29-12-15(2)25-13-29/h4-9,12-14,20H,10-11H2,1-3H3 |
| InChIKey | UFKVTZFHOUXVDD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |