C30H38F3N7O2Si — CID 67347217
2,2-dimethyl-1-[2-[3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one (PubChem CID 67347217) has the molecular formula C30H38F3N7O2Si and a molecular weight of 613.76 g/mol. Its IUPAC name is 2,2-dimethyl-1-[2-[3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[2-[3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 67347217 |
| Molecular Formula | C30H38F3N7O2Si |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | 2,2-dimethyl-1-[2-[3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]propan-1-one |
| SMILES | CC(C)(C)C(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3cccc(CN4CCn5c(nnc5C(F)(F)F)C4)c3)nc12 |
| InChI | InChI=1S/C30H38F3N7O2Si/c1-29(2,3)26(41)22-17-39(19-42-12-13-43(4,5)6)27-25(22)35-23(15-34-27)21-9-7-8-20(14-21)16-38-10-11-40-24(18-38)36-37-28(40)30(31,32)33/h7-9,14-15,17H,10-13,16,18-19H2,1-6H3 |
| InChIKey | BLWILXHCMFPOFJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|