C19H25ClFN3OS — CID 67347735
N-(4-chloro-2-fluorophenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide (PubChem CID 67347735) has the molecular formula C19H25ClFN3OS and a molecular weight of 397.95 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 67347735 |
| Molecular Formula | C19H25ClFN3OS |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-(2-cycloheptylimino-3-methyl-1,3-thiazolidin-4-yl)acetamide |
| SMILES | CN1/C(=N/C2CCCCCC2)SCC1CC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C19H25ClFN3OS/c1-24-15(11-18(25)23-17-9-8-13(20)10-16(17)21)12-26-19(24)22-14-6-4-2-3-5-7-14/h8-10,14-15H,2-7,11-12H2,1H3,(H,23,25)/b22-19- |
| InChIKey | DFODLYSWLLLNAW-QOCHGBHMSA-N |
| XLogP | 4.93 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|