C20H21ClFN3OS — CID 67347743
N-(4-chloro-2-fluorophenyl)-2-[2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide (PubChem CID 67347743) has the molecular formula C20H21ClFN3OS and a molecular weight of 405.93 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 67347743 |
| Molecular Formula | C20H21ClFN3OS |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[2-(4-ethylphenyl)imino-3-methyl-1,3-thiazolidin-4-yl]acetamide |
| SMILES | CCc1ccc(/N=C2\SCC(CC(=O)Nc3ccc(Cl)cc3F)N2C)cc1 |
| InChI | InChI=1S/C20H21ClFN3OS/c1-3-13-4-7-15(8-5-13)23-20-25(2)16(12-27-20)11-19(26)24-18-9-6-14(21)10-17(18)22/h4-10,16H,3,11-12H2,1-2H3,(H,24,26)/b23-20- |
| InChIKey | HFFRVQMFMIYTGO-ATJXCDBQSA-N |
| XLogP | 5.11 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|