C18H19ClF3NO2 — CID 67347792
3-[2-(1-phenylethoxy)-5-(trifluoromethyl)phenoxy]azetidine;hydrochloride (PubChem CID 67347792) has the molecular formula C18H19ClF3NO2 and a molecular weight of 373.80 g/mol. Its IUPAC name is 3-[2-(1-phenylethoxy)-5-(trifluoromethyl)phenoxy]azetidine;hydrochloride.
| Compound Name | 3-[2-(1-phenylethoxy)-5-(trifluoromethyl)phenoxy]azetidine;hydrochloride |
|---|---|
| PubChem CID | 67347792 |
| Molecular Formula | C18H19ClF3NO2 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-[2-(1-phenylethoxy)-5-(trifluoromethyl)phenoxy]azetidine;hydrochloride |
| SMILES | CC(Oc1ccc(C(F)(F)F)cc1OC1CNC1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H18F3NO2.ClH/c1-12(13-5-3-2-4-6-13)23-16-8-7-14(18(19,20)21)9-17(16)24-15-10-22-11-15;/h2-9,12,15,22H,10-11H2,1H3;1H |
| InChIKey | AYRBOGDXGSNAFF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |