C21H24O4 — CID 67349811
(8R,9S,13S,14S,16E)-16-(ethoxymethylidene)-3-hydroxy-13-methyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-6,17-dione (PubChem CID 67349811) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (8R,9S,13S,14S,16E)-16-(ethoxymethylidene)-3-hydroxy-13-methyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-6,17-dione.
| Compound Name | (8R,9S,13S,14S,16E)-16-(ethoxymethylidene)-3-hydroxy-13-methyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-6,17-dione |
|---|---|
| PubChem CID | 67349811 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (8R,9S,13S,14S,16E)-16-(ethoxymethylidene)-3-hydroxy-13-methyl-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-6,17-dione |
| SMILES | CCO/C=C1\C[C@H]2[C@@H]3CC(=O)c4cc(O)ccc4[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C21H24O4/c1-3-25-11-12-8-18-16-10-19(23)17-9-13(22)4-5-14(17)15(16)6-7-21(18,2)20(12)24/h4-5,9,11,15-16,18,22H,3,6-8,10H2,1-2H3/b12-11+/t15-,16-,18+,21+/m1/s1 |
| InChIKey | ITWIZVMMHIYUJY-ZOEQGTSSSA-N |
| XLogP | 3.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|