C19H22O2 — CID 54338170
(13S)-3-hydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-6-one (PubChem CID 54338170) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (13S)-3-hydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | (13S)-3-hydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 54338170 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (13S)-3-hydroxy-13-methyl-17-methylidene-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-6-one |
| SMILES | C=C1CCC2C3CC(=O)c4cc(O)ccc4C3CC[C@]12C |
| InChI | InChI=1S/C19H22O2/c1-11-3-6-17-15-10-18(21)16-9-12(20)4-5-13(16)14(15)7-8-19(11,17)2/h4-5,9,14-15,17,20H,1,3,6-8,10H2,2H3/t14?,15?,17?,19-/m1/s1 |
| InChIKey | TWZXSPWHLMNKRF-ZFMVVSJCSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|