C19H19NO3 — CID 11558624
(8R,9S,13S,14S)-3-hydroxy-13-methyl-6,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2-carbonitrile (PubChem CID 11558624) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is (8R,9S,13S,14S)-3-hydroxy-13-methyl-6,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2-carbonitrile.
| Compound Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-6,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 11558624 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (8R,9S,13S,14S)-3-hydroxy-13-methyl-6,17-dioxo-7,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-2-carbonitrile |
| SMILES | C[C@]12CC[C@@H]3c4cc(C#N)c(O)cc4C(=O)C[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H19NO3/c1-19-5-4-11-12-6-10(9-20)16(21)8-14(12)17(22)7-13(11)15(19)2-3-18(19)23/h6,8,11,13,15,21H,2-5,7H2,1H3/t11-,13-,15+,19+/m1/s1 |
| InChIKey | OMDUUGFIUNRFLM-YVOWVQIISA-N |
| XLogP | 3.33 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |