C15H12F3N3O3S — CID 6735005
N-(1H-benzimidazol-2-ylmethyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 6735005) has the molecular formula C15H12F3N3O3S and a molecular weight of 371.34 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 6735005 |
| Molecular Formula | C15H12F3N3O3S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1nc2ccccc2[nH]1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H12F3N3O3S/c16-15(17,18)24-12-7-3-4-8-13(12)25(22,23)19-9-14-20-10-5-1-2-6-11(10)21-14/h1-8,19H,9H2,(H,20,21) |
| InChIKey | UGVBUWGZSASDSM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |